Carboxylic acids and derivatives
Filtered Search Results
Sodium DL-Lactate (60% in Water), TCI America™
CAS: 72-17-3 Molecular Formula: C3H5NaO3 Molecular Weight (g/mol): 112.06 MDL Number: MFCD00065400 InChI Key: NGSFWBMYFKHRBD-UHFFFAOYSA-M Synonym: sodium lactate,lactic acid sodium salt,monosodium lactate,sodium dl-lactate,lacolin,per-glycerin,lactic acid, monosodium salt,sodium alpha-hydroxypropionate,monosodium 2-hydroxypropanoate,propanoic acid, 2-hydroxy-, monosodium salt PubChem CID: 23666456 ChEBI: CHEBI:75228 IUPAC Name: sodium;2-hydroxypropanoate SMILES: CC(C(=O)[O-])O.[Na+]
| PubChem CID | 23666456 |
|---|---|
| CAS | 72-17-3 |
| Molecular Weight (g/mol) | 112.06 |
| ChEBI | CHEBI:75228 |
| MDL Number | MFCD00065400 |
| SMILES | CC(C(=O)[O-])O.[Na+] |
| Synonym | sodium lactate,lactic acid sodium salt,monosodium lactate,sodium dl-lactate,lacolin,per-glycerin,lactic acid, monosodium salt,sodium alpha-hydroxypropionate,monosodium 2-hydroxypropanoate,propanoic acid, 2-hydroxy-, monosodium salt |
| IUPAC Name | sodium;2-hydroxypropanoate |
| InChI Key | NGSFWBMYFKHRBD-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO3 |
4-Hydroxybenzamide, 98+%
CAS: 619-57-8 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007997 InChI Key: QXSAKPUBHTZHKW-UHFFFAOYSA-N Synonym: benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide PubChem CID: 65052 IUPAC Name: 4-hydroxybenzamide SMILES: NC(=O)C1=CC=C(O)C=C1
| PubChem CID | 65052 |
|---|---|
| CAS | 619-57-8 |
| Molecular Weight (g/mol) | 137.14 |
| MDL Number | MFCD00007997 |
| SMILES | NC(=O)C1=CC=C(O)C=C1 |
| Synonym | benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide |
| IUPAC Name | 4-hydroxybenzamide |
| InChI Key | QXSAKPUBHTZHKW-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
tert-Butyl Acetate 99.0+%, TCI America™
CAS: 540-88-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008807 InChI Key: WMOVHXAZOJBABW-UHFFFAOYSA-N Synonym: t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate PubChem CID: 10908 IUPAC Name: tert-butyl acetate SMILES: CC(=O)OC(C)(C)C
| PubChem CID | 10908 |
|---|---|
| CAS | 540-88-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008807 |
| SMILES | CC(=O)OC(C)(C)C |
| Synonym | t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate |
| IUPAC Name | tert-butyl acetate |
| InChI Key | WMOVHXAZOJBABW-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Trimethylacetic acid, 99%
CAS: 75-98-9 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00004194 InChI Key: IUGYQRQAERSCNH-UHFFFAOYSA-N Synonym: pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid PubChem CID: 6417 ChEBI: CHEBI:45133 IUPAC Name: 2,2-dimethylpropanoic acid SMILES: CC(C)(C)C(=O)O
| PubChem CID | 6417 |
|---|---|
| CAS | 75-98-9 |
| Molecular Weight (g/mol) | 102.133 |
| ChEBI | CHEBI:45133 |
| MDL Number | MFCD00004194 |
| SMILES | CC(C)(C)C(=O)O |
| Synonym | pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid |
| IUPAC Name | 2,2-dimethylpropanoic acid |
| InChI Key | IUGYQRQAERSCNH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Methyl Benzoate 99.0+%, TCI America™
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008421 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| MDL Number | MFCD00008421 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
Isopropyl Palmitate 97.0+%, TCI America™
CAS: 142-91-6 Molecular Formula: C19H38O2 Molecular Weight (g/mol): 298.51 MDL Number: MFCD00008993 InChI Key: XUGNVMKQXJXZCD-UHFFFAOYSA-N Synonym: isopropyl palmitate,isopropyl hexadecanoate,isopalm,deltyl,isopal,propal,deltyl prime,tegester isopalm,ja-fa ippkessco,sinnoester pit PubChem CID: 8907 ChEBI: CHEBI:84262 IUPAC Name: propan-2-yl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OC(C)C
| PubChem CID | 8907 |
|---|---|
| CAS | 142-91-6 |
| Molecular Weight (g/mol) | 298.51 |
| ChEBI | CHEBI:84262 |
| MDL Number | MFCD00008993 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(C)C |
| Synonym | isopropyl palmitate,isopropyl hexadecanoate,isopalm,deltyl,isopal,propal,deltyl prime,tegester isopalm,ja-fa ippkessco,sinnoester pit |
| IUPAC Name | propan-2-yl hexadecanoate |
| InChI Key | XUGNVMKQXJXZCD-UHFFFAOYSA-N |
| Molecular Formula | C19H38O2 |
Ethyl palmitate, 97%
CAS: 628-97-7 Molecular Formula: C18H36O2 Molecular Weight (g/mol): 284.48 MDL Number: MFCD00008996 InChI Key: XIRNKXNNONJFQO-UHFFFAOYSA-N Synonym: ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm PubChem CID: 12366 ChEBI: CHEBI:84932 IUPAC Name: ethyl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 12366 |
|---|---|
| CAS | 628-97-7 |
| Molecular Weight (g/mol) | 284.48 |
| ChEBI | CHEBI:84932 |
| MDL Number | MFCD00008996 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm |
| IUPAC Name | ethyl hexadecanoate |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Molecular Formula | C18H36O2 |
Ethyl myristate, 98+%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
Ethyl stearate, 97%
CAS: 111-61-5 Molecular Formula: C20H40O2 Molecular Weight (g/mol): 312.52 MDL Number: MFCD00009006 InChI Key: MVLVMROFTAUDAG-UHFFFAOYSA-N Synonym: ethyl stearate,stearic acid ethyl ester,octadecanoic acid, ethyl ester,ethyl n-octadecanoate,stearic acid, ethyl ester,dicyclohexylammonium sulfate,unii-c64rtc734w,fema no. 3490,ethyl-stearate,ethyloctadecanoate PubChem CID: 8122 ChEBI: CHEBI:84936 IUPAC Name: ethyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 8122 |
|---|---|
| CAS | 111-61-5 |
| Molecular Weight (g/mol) | 312.52 |
| ChEBI | CHEBI:84936 |
| MDL Number | MFCD00009006 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl stearate,stearic acid ethyl ester,octadecanoic acid, ethyl ester,ethyl n-octadecanoate,stearic acid, ethyl ester,dicyclohexylammonium sulfate,unii-c64rtc734w,fema no. 3490,ethyl-stearate,ethyloctadecanoate |
| IUPAC Name | ethyl octadecanoate |
| InChI Key | MVLVMROFTAUDAG-UHFFFAOYSA-N |
| Molecular Formula | C20H40O2 |
2,2,2-Trifluoroethyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
Triethyl citrate, 99%
CAS: 77-93-0 Molecular Formula: C12H20O7 Molecular Weight (g/mol): 276.285 MDL Number: MFCD00009201 InChI Key: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC Name: triethyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| CAS | 77-93-0 |
| Molecular Weight (g/mol) | 276.285 |
| MDL Number | MFCD00009201 |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molecular Formula | C12H20O7 |
trans-Aconitic acid, 98%
CAS: 4023-65-8 Molecular Formula: C6H6O6 Molecular Weight (g/mol): 174.108 MDL Number: MFCD00002721 InChI Key: GTZCVFVGUGFEME-HNQUOIGGSA-N Synonym: trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid PubChem CID: 444212 ChEBI: CHEBI:32806 IUPAC Name: (E)-prop-1-ene-1,2,3-tricarboxylic acid SMILES: C(C(=CC(=O)O)C(=O)O)C(=O)O
| PubChem CID | 444212 |
|---|---|
| CAS | 4023-65-8 |
| Molecular Weight (g/mol) | 174.108 |
| ChEBI | CHEBI:32806 |
| MDL Number | MFCD00002721 |
| SMILES | C(C(=CC(=O)O)C(=O)O)C(=O)O |
| Synonym | trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid |
| IUPAC Name | (E)-prop-1-ene-1,2,3-tricarboxylic acid |
| InChI Key | GTZCVFVGUGFEME-HNQUOIGGSA-N |
| Molecular Formula | C6H6O6 |
n-Propyl propionate, 99%
CAS: 106-36-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009373 InChI Key: MCSINKKTEDDPNK-UHFFFAOYSA-N Synonym: propyl propionate,n-propyl propionate,propanoic acid, propyl ester,n-propyl propanoate,propionic acid, propyl ester,n-propyl n-propionate,propylester kyseliny propionove,unii-g09trv00gk,propyl propionate natural,propionic acid n-propyl ester PubChem CID: 7803 IUPAC Name: propyl propanoate SMILES: CCCOC(=O)CC
| PubChem CID | 7803 |
|---|---|
| CAS | 106-36-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00009373 |
| SMILES | CCCOC(=O)CC |
| Synonym | propyl propionate,n-propyl propionate,propanoic acid, propyl ester,n-propyl propanoate,propionic acid, propyl ester,n-propyl n-propionate,propylester kyseliny propionove,unii-g09trv00gk,propyl propionate natural,propionic acid n-propyl ester |
| IUPAC Name | propyl propanoate |
| InChI Key | MCSINKKTEDDPNK-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Isopropyl acetate, 99%, pure
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.13 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Citric acid, disodium salt sesquihydrate, 99%, pure
CAS: 1545832 Molecular Formula: C12H18Na4O17 Molecular Weight (g/mol): 526.22 MDL Number: MFCD00150445 InChI Key: HGPVLOQNBSHYEI-UHFFFAOYNA-J Synonym: unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 PubChem CID: 117063816 IUPAC Name: tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate SMILES: C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 117063816 |
|---|---|
| CAS | 1545832 |
| Molecular Weight (g/mol) | 526.22 |
| MDL Number | MFCD00150445 |
| SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+] |
| Synonym | unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 |
| IUPAC Name | tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate |
| InChI Key | HGPVLOQNBSHYEI-UHFFFAOYNA-J |
| Molecular Formula | C12H18Na4O17 |